Bax inhibitor peptide, negative control
| Supplier | Creative Peptides |
|---|---|
| Product # | R0847 |
| CAS # | 1315378-74-5 |
| Pricing | Inquire |
| MolecularFormula | C28H52N6O6S |
| MolecularWeight | 600.82 |
| Sequence | IPMIK |
| Storage | -20°C |
| Explanation | Negative control peptide for Bax inhibitor peptide V5, which inhibits Bax translocation to mitochondria and Bax-mediated apoptosis in vitro. |
| Activity | Inhibitor |
| InChI | InChI=1S/C28H52N6O6S/c1-6-17(3)22(30)27(38)34-15-10-12-21(34)25(36)31-19(13-16-41-5)24(35)33-23(18(4)7-2)26(37)32-20(28(39)40)11-8-9-14-29/h17-23H,6-16,29-30H2,1-5H3,(H,31,36)(H,32,37)(H,33,35)(H,39,40)/t17-,18-,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | VRWAAYKVABJBAQ-FQJIPJFPSA-N |
| IsomericSMILES | CC[C@H](C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCSC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)O)N |
| Appearance | White lyophilised solid |
| Purity | >98 % |
| LongTermStorageConditions | -20 °C |