Tos-PEG1-acid
Tos-PEG1-acid contains a tosyl group and a terminal carboxylic acid. Tosyl group is a very good leaving group for nucleophilic substitution reaction. Terminal carboxylic acid is easy to react with primary and secondary amines and form stable amide bonds in the presence of activators (e.g. EDC, or DCC) to form a stable amide bond. The hydrophilic PEG spacer increases the solubility in aqueous media.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-3454 |
| Pricing | Inquire |
| Cas | 1259387-78-4 |
| Molecular Weight | 244.26 |
| Molecular Formula | C10H12O5S |
| Canonical SMILES | CC1=CC=C(S(=O)(OCCC(O)=O)=O)C=C1 |