Cabotegravir-[13C,d5]
Cabotegravir-[13C,d5], is the labelled analogue of Cabotegravir. Cabotegravir (GSK744, GSK1265744) is a long-acting HIV integrase inhibitor against a broad range of HIV subtypes, and inhibits the HIV-1 integrase catalyzed strand transfer reaction with IC50 of 3.0 nM. Phase 2.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002125 |
| Pricing | Inquire |
| Molecular Weight | 411.38 |
| Molecular Formula | C18[13C]H12D5F2N3O5 |
| Canonical SMILES | CC1COC2N1C(=O)C3=C(C(=O)C(=CN3C2)C(=O)NCC4=C(C=C(C=C4)F)F)O |