N- Propyl- N- [2- (2, 4, 6- trichlorophenoxy) ethyl] - carbamic Acid Methyl Ester
N- Propyl- N- [2- (2, 4, 6- trichlorophenoxy) ethyl] - carbamic Acid Methyl Ester is an intermediate used in the synthesis of BTS 44595 (B689350), which is a metabolite of Prochloraz (P755280), an effective fungicide against cereal powdery mildew.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058013 |
| Pricing | Inquire |
| Cas | 1424939-65-0 |
| Molecular Weight | 340.63 |
| Molecular Formula | C13H16Cl3NO3 |
| Canonical SMILES | CCCN(CCOC1=C(C=C(C=C1Cl)Cl)Cl)C(=O)OC |