A 412997 dihydrochloride
A 412997 dihydrochloride is a potent and selective agonist for the dopamine D4 receptor (Ki = 7.9 and 12.1 nM for human D4 and rat D4, receptors) with no activity for other dopamine receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1347744-96-0 |
| Pricing | Inquire |
| Cas | 1347744-96-0 |
| Molecular Weight | 382.33 |
| Molecular Formula | C19H23N3O.2HCl |
| Canonical SMILES | CC1=CC(=CC=C1)NC(=O)CN2CCC(CC2)C3=CC=CC=N3.Cl.Cl |