Centrinone B
Centrinone B, has been found to be a high affinity and selective PLK4 inhibitor (Ki: 0.6 nM) and exhibit more than 2000-fold selectivity for PLK4 over Aurora A and Aurora B.
Supplier | BOC Sciences |
---|---|
Product # | 1798871-31-4 |
Pricing | Inquire |
Cas | 1798871-31-4 |
Molecular Weight | 631.67 |
Molecular Formula | C27H27F2N7O5S2 |
Canonical SMILES | CC1=CC(=NN1)NC2=NC(=NC(=C2OC)N3CCCCC3)SC4=C(C=C(C=C4)S(=O)(=O)CC5=C(C(=CC=C5)[N+](=O)[O-])F)F |