trans-beta-D-Glucopyranosyl methylacetoacetate
trans-beta-D-Glucopyranosyl methylacetoacetate is an intriguing derivative of glucose illuminating a path towards revolutionizing the research of diabetes and other intertwined metabolic ailments. It showcases propitious characteristics for precisely modulating the intricate web of glucose metabolism and sensitizing insulin responsiveness.
| Supplier | BOC Sciences |
|---|---|
| Product # | 55018-21-8 |
| Pricing | Inquire |
| Cas | 55018-21-8 |
| Molecular Weight | 278.26 |
| Molecular Formula | C11H18O8 |
| Canonical SMILES | CC(C(=O)C)C(=O)OC1C(C(C(C(O1)CO)O)O)O |