4-Nitrophenyl b-D-galactopyranosiduronic acid
4-Nitrophenyl b-D-galactopyranosiduronic acid, an indispensable compound in the field of biomedicine, plays a crucial role in the detection and therapy of lysosomal storage disorders, exerting its effect as a substrate that enables the assessment of particular enzyme activities engaged in the hydrolysis of glycosidic bonds.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39031-76-0 |
| Pricing | Inquire |
| Cas | 39031-76-0 |
| Molecular Weight | 315.23 |
| Molecular Formula | C12H13NO9 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)C(=O)O)O)O)O |