4,4-Carbonyldibenzoic Acid
4,4-Carbonyldibenzoic Acid is a key intermediate used in the synthesis of various pharmaceutical compounds. It is commonly employed in the production of nonsteroidal anti-inflammatory drugs (NSAIDs) such as ibuprofen and indomethacin.
| Supplier | BOC Sciences |
|---|---|
| Product # | 964-68-1 |
| Pricing | Inquire |
| Cas | 964-68-1 |
| Molecular Weight | 270.24 |
| Molecular Formula | C15H10O5 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)C(=O)O)C(=O)O |