5-Hydroxyisophthalic acid
5-Hydroxyisophthalic acid is used as a reagent in the synthesis of silver carboxylate metal organic framework (MOF) complexes. 5-Hydroxyisophthalic Acid is also used as the starting material in the synthesis of N,N'-Bis(2,3-dihydroxypropyl)-5-[(N-(2-hydroxyethyl)carbamoyl)methoxy]-2,4,6-triiodoisophthalamide. It is a compound related to Ioversol which is a nonionic, low osmolality, radiographic contrast agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-323080 |
| Pricing | Inquire |
| Cas | 618-83-7 |
| Molecular Weight | 182.13 |
| Molecular Formula | C8H6O5 |
| Canonical SMILES | C1=C(C=C(C=C1C(=O)O)O)C(=O)O |