N-Boc-pyrrole-2-boronic acid MIDA ester
Suzuki Cross-Coupling with MIDA Boronates
N-Boc-pyrrole-2-boronic acid MIDA ester can be used:• As a starting material for the synthesis of marine natural product pentabromopseudilin.• To prepare 5,5'-(3,4-dihexylthiophene-2,5-diyl)bis(1H-pyrrole-2-carbaldehyde), a key intermediate for the synthesis of thiophene based novel macrocycles.• As a substrate in the palladium-catalyzed one-pot meta arylation of bromo substituted 2-phenylpyridine.
N-Boc-pyrrole-2-boronic acid MIDA ester can be used:• As a starting material for the synthesis of marine natural product pentabromopseudilin.• To prepare 5,5'-(3,4-dihexylthiophene-2,5-diyl)bis(1H-pyrrole-2-carbaldehyde), a key intermediate for the synthesis of thiophene based novel macrocycles.• As a substrate in the palladium-catalyzed one-pot meta arylation of bromo substituted 2-phenylpyridine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1158984-94-1 |
| Pricing | Inquire |
| Cas | 1158984-94-1 |
| Molecular Weight | 322.12 |
| Molecular Formula | C14H19BN2O6 |
| Canonical SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=CN2C(=O)OC(C)(C)C |