5'-O-DMT-N2-isobutyryl-2'-O-methylguanosine
5'-O-DMT-N2-isobutyryl-2'-O-methylguanosine, a remarkable antiviral agent employed in advanced biomedical investigations, defies viral replication across diverse strains, such as the treacherous influenza and herpes simplex virus. Equally significant, this compound boasts unrivaled eminence in probing RNA biology and delineating protein synthesis intricacies. Scientific affluence beckons its application, impelling groundbreaking inquiries exploring viral replication mechanisms and pioneering antiviral therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114745-26-5 |
| Pricing | Inquire |
| Cas | 114745-26-5 |
| Molecular Weight | 669.74 |
| Molecular Formula | C36H39N5O8 |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O)OC |