Acetyl Tetrapeptide-2
Acetyl Tetrapeptide-2 is a four amino acid peptide that can stimulate the skin's immune defenses and help skin regeneration. It can promote FBLN5 and LOXL1 synthesis and enhance their activity, improve skin firmness.
Supplier | BOC Sciences |
---|---|
Product # | BAT-009988 |
Pricing | Inquire |
Cas | 757942-88-4 |
Molecular Weight | 565.61 |
Molecular Formula | C26H39N5O9 |
Canonical SMILES | CC(C)C(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CCCCN)NC(=O)C |