5'-O-Trityl-2',3'-dehydrothymidine
5'-O-Trityl-2',3'-dehydrothymidine, a pharmaceutical compound utilized in the treatment of viral infections, exerts its effect through its capacity to thwart the replication of viral DNA. This unique substance has demonstrated robust potential as a building block in the development of therapeutic interventions targeting notoriously challenging viruses such as hepatitis B and C.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5964-41-0 |
| Pricing | Inquire |
| Cas | 5964-41-0 |
| Molecular Weight | 466.53 |
| Molecular Formula | C29H26N2O4 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C=CC(O2)COC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5 |