3-(Methylamino)-2-nitrobenzoic Acid
3-(Methylamino)-2-nitrobenzoic Acid is an intermediate in the synthesis of Endophenazine B (E555485), a new phenazine antibiotic isolated from the arthropod associated endosymbiont Streptomyces anulatus and shows antimicrobial activities against Gram-positive bacteria and some filamentous fungi, and herbicidal activity against Lemna minor (duckweed).
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058954 |
| Pricing | Inquire |
| Cas | 124341-37-3 |
| Molecular Weight | 196.16 |
| Molecular Formula | C8H8N2O4 |
| Canonical SMILES | CNC1=CC=CC(=C1[N+](=O)[O-])C(=O)O |