β-(Trifluoromethyl)phenylalanine
β-(Trifluoromethyl)phenylalanine is a protected amino acid used in the synthesis of pharmacologically active compounds. Phenylalanine (P319415) is an essential amino acid. L-Phenylalanine is biologically converted into L-tyrosine, another one of the DNA-encoded amino acids, which in turn is converted to L-DOPA and further converted into dopamine, norepinephrine, and epinephrine.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB057210 |
| Pricing | Inquire |
| Cas | 114829-12-8 |
| Molecular Weight | 233.19 |
| Molecular Formula | C10H10F3NO2 |
| Canonical SMILES | C1=CC=C(C=C1)C(C(C(=O)O)N)C(F)(F)F |