5-Dimethylamino-5-deoxy-1,2-O-isopropylidene-a-D-xylofuranose
5-Dimethylamino-5-deoxy-1,2-O-isopropylidene-α-D-xylofuranose is a biomedical ingredient exhibiting potential antiviral properties and commonly utilized as a building block in organic research and development. This compound can be employed to develop pharmaceutical drugs targeting viral infections or as a key component in drug discovery and research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 145147-43-9 |
| Pricing | Inquire |
| Cas | 145147-43-9 |
| Molecular Weight | 217.26 |
| Molecular Formula | C10H19NO4 |
| Canonical SMILES | CC1(OC2C(C(OC2O1)CN(C)C)O)C |