Ramelteon Impurity 17
Ramelteon Impurity 17 is an impurity of Ramelteon. Ramelteon is a potent and selective agonist at melatonin MT1/MT2 receptor. Ramelteon is a sleep agent medication used to treat sleeplessness (insomnia).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1365920-38-2 |
| Pricing | Inquire |
| Cas | 1365920-38-2 |
| Molecular Weight | 389.54 |
| Molecular Formula | C26H31NO2 |
| Canonical SMILES | C1CC2=C(C1CCNCCC3CCC4=C3C5=C(C=C4)OCC5)C6=C(C=C2)OCC6 |