Alkyne-SNAP
Alkyne-SNAP is an Alkyne-conjugated benzylguanine. The BG moiety reacts specifically and rapidly with the so-called SNAP-tag, a polypeptide protein tag, allowing irreversible and covalent labeling of SNAP fusion proteins with an additional alkyne functionality suitable for further conjugation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01717 |
| Pricing | Inquire |
| Cas | 1104822-07-2 |
| Molecular Weight | 350.37 |
| Molecular Formula | C18H18N6O2 |
| Canonical SMILES | C#CCCC(=O)NCC1=CC=C(C=C1)COC2=NC(=NC3=C2NC=N3)N |