Piperacillin EP Impurity B (Mixture of Diastereomers)
Piperacillin EP Impurity B (Mixture of Diastereomers) is an impurity of Piperacillin, which is a broad-spectrum antibiotic used to treat serious, hospital-acquired infections in combination with the beta lactamase inhibitor tazobactam.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2649505-14-4 |
| Pricing | Inquire |
| Cas | 2649505-14-4 |
| Molecular Weight | 535.57 |
| Molecular Formula | C23H29N5O8S |
| Canonical SMILES | CCN1CCN(C(=O)C1=O)C(=O)NC(C2=CC=CC=C2)C(=O)NC(C3NC(C(S3)(C)C)C(=O)O)C(=O)O |