Oxytetracycline EP Impurity F
Oxytetracycline EP Impurity F is an impurity of Oxytetracycline, which is a broad-spectrum tetracycline antibiotic used for the treatment of various infectious diseases, like anthrax, Chlamydia, cholera, typhus, relapsing fever, malaria, plaque, syphilis, respiratory infection, streptococcal infection, and acne.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4660-26-8 |
| Pricing | Inquire |
| Cas | 4660-26-8 |
| Molecular Weight | 442.42 |
| Molecular Formula | C22H22N2O8 |
| Canonical SMILES | O=C(N)C=1C(=O)C2(O)C(=O)C=3C(O)=C4C(O)=CC=CC4=C(C3C(O)C2C(C1O)N(C)C)C |