8-Formyl ophiopogonone B
8-Formyl ophiopogonone B is a remarkable natural compound, holding promise for studying diverse ailments. Its exceptional ability to specifically target malignant cells and impede the proliferation of tumors has garnered considerable attention.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1316224-74-4 |
| Pricing | Inquire |
| Cas | 1316224-74-4 |
| Molecular Weight | 340.33 |
| Molecular Formula | C19H16O6 |
| Canonical SMILES | CC1=C(C(=C2C(=C1O)C(=O)C(=CO2)CC3=CC=C(C=C3)OC)C=O)O |