b-D-Thioglucose sodium salt
b-D-Thioglucose sodium salt, a chemical compound ubiquitous in medical research, has been applied extensively in studies exploring the intricacies of glucose metabolism which are of paramount importance in the advancement of our knowledge about diabetes. Additionally, it has shown promising capabilities in drug development which focus on glucose transporters and has garnered significant excitement for its potential to revolutionize personalized medicine for metabolic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10593-29-0 |
| Pricing | Inquire |
| Cas | 10593-29-0 |
| Molecular Weight | 218.21 |
| Molecular Formula | C6H11NaO5S |
| Canonical SMILES | C(C1C(C(C(C(O1)[S-])O)O)O)O.[Na+] |