Sephin 1
Sephin 1 is a selective PPP1R15A inhibitor devoid of PPP1R15B and α2-adrenergic activity. In cells, Sephin 1 selectively disrupted the PPP1R15A-PP1c complex, thus prolonging eIF2α phosphorylation after stress, delaying translation recovery, and attenuated expression of stress genes such as the pro-apoptotic protein CHOP. In mice, Sephin 1 safely prevented the motor, morphological, and molecular defects of two otherwise unrelated protein-misfolding diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-055259 |
| Pricing | Inquire |
| Cas | 951441-04-6 |
| Molecular Weight | 196.64 |
| Molecular Formula | C8H9ClN4 |
| Canonical SMILES | C1=CC=C(C(=C1)C=NN=C(N)N)Cl |