Simvastatin EP Impurity H
An intermediate in the synthesis of Simvastatin, Simvastatin is a lipid-lowering drug that inhibits HMG-CoA reductase. It is in the statin class of medications and works by decreasing the manufacture of cholesterol by the liver.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-257205 |
| Pricing | Inquire |
| Cas | 79952-42-4 |
| Molecular Weight | 320.43 |
| Molecular Formula | C19H28O4 |
| Canonical SMILES | CC1CC(C2C(C(C=CC2=C1)C)CCC3CC(CC(=O)O3)O)O |