β-L-Fucose-1-phosphate cyclohexylammonium salt
β-L-Fucose-1-phosphate cyclohexylammonium salt, a paramount compound employed within the biomedical field, assumes an indispensable position. Its indispensable nature emanates from its efficacy in addressing an array of ailments, particularly diverse cancer variants and autoimmune disorders. Manifesting distinctive attributes, it effectively impedes the activity of specific enzymes pivotal to disease advancement, thereby emerging as a pivotal catalyst for the creation of focused therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40591-57-9 |
| Pricing | Inquire |
| Cas | 40591-57-9 |
| Molecular Weight | 442.48 |
| Molecular Formula | C18H39N2O8P |
| Canonical SMILES | CC1C(C(C(C(O1)OP(=O)([O-])[O-])O)O)O.C1CCC(CC1)[NH3+].C1CCC(CC1)[NH3+] |