(N6-Benzoyl)-5'-O-[(N,N-diisopropylamino)-(2-cyanoethoxy)phosphinyl]-3'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine
(N6-Benzoyl)-5'-O-[(N,N-diisopropylamino)-(2-cyanoethoxy)phosphinyl]-3'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine is a modified phosphoramidite used in oligonucleotide synthesis. This compound includes protective groups such as dimethoxytrityl (DMT), benzoyl (Bz), and cyanoethyl (CE). These protective groups play a crucial role in the synthesis process, ensuring correct assembly and sequence synthesis of nucleotides, particularly in reverse synthesis (from the 5' to 3' end).
| Supplier | BOC Sciences |
|---|---|
| Product # | 140712-82-9 |
| Pricing | Inquire |
| Cas | 140712-82-9 |
| Molecular Weight | 857.93 |
| Molecular Formula | C47H52N7O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC1C(CC(O1)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)OC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |