1-Chloro-2-deoxy-3,4-di-O-toluoyl-D-ribopyranose
1-Chloro-2-deoxy-3,4-di-O-toluoyl-D-ribopyranose is an organic molecule with multifarious applications in natural product synthesis. By virtue of its pharmacological properties, it has emerged as a promising player in the realm of cancer therapy and other afflictions. Its potential use in treating various diseases has garnered considerable attention from the scientific community.
| Supplier | BOC Sciences |
|---|---|
| Product # | 516511-18-5 |
| Pricing | Inquire |
| Cas | 516511-18-5 |
| Molecular Weight | 388.84 |
| Molecular Formula | C21H21ClO5 |
| Canonical SMILES | CC1=CC=CC=C1C(=O)C2(CC(OCC2(C(=O)C3=CC=CC=C3C)O)(O)Cl)O |