5'-O-DMT-2'-O-TBDMS-N4-Benzoyl-5-Methy-Cytidine 3'-CE phosphoramidite
The 5'-O-DMT-2'-O-TBDMS-N4-Benzoyl-5-Methy-Cytidine 3'-CE phosphoramidite, an indispensable tool in biomedicine, is utilized for oligonucleotide synthesis. Its application extends to treatments for cancer, viral infections, and genetic disorders, imparting significant progress in medical science. This product aptly aids the creation of innovative drugs and therapies that can possibly enhance patient outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 160107-14-2 |
| Pricing | Inquire |
| Cas | 160107-14-2 |
| Molecular Weight | 978.21 |
| Molecular Formula | C53H68N5O9PSi |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N)O[Si](C)(C)C(C)(C)C |