7-epi-10-Oxo-10-deacetyl Baccatin III
7-epi-10-Oxo-10-deacetyl Baccatin III is an impurity of Docetaxel, which is a semisynthetic derivative of Paclitaxel used to treat a variety of cancers, including breast, head and neck, stomach, prostate, and non-small cell lung cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 151636-94-1 |
| Pricing | Inquire |
| Cas | 151636-94-1 |
| Molecular Weight | 542.57 |
| Molecular Formula | C29H34O10 |
| Canonical SMILES | CC1=C2C(=O)C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1O)O)OC(=O)C5=CC=CC=C5)(CO4)OC(=O)C)O)C |