Amifampridine Phosphate
Amifampridine is a drug, predominantly used to treat many of the congenital myasthenic syndromes, particularly those with defects in choline acetyltransferase, downstream kinase 7, and those where any kind of defect causes "fast channel" behaviour of the acetylcholine receptor.
| Supplier | BOC Sciences |
|---|---|
| Product # | 446254-47-3 |
| Pricing | Inquire |
| Cas | 446254-47-3 |
| Molecular Weight | 207.12 |
| Molecular Formula | C5H10N3O4P |
| Canonical SMILES | C1=CN=CC(=C1N)N.OP(=O)(O)O |