3-Nitrosalicylic acid
3-Nitrosalicylic Acid is a nitrohumic acid which has been shown to bind to Molybdenum to impart fertility to soil and water and is a key element in the activity of nitrogenase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 85-38-1 |
| Pricing | Inquire |
| Cas | 85-38-1 |
| Molecular Weight | 183.12 |
| Molecular Formula | C7H5NO5 |
| Canonical SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])O)C(=O)O |