Aflatoxin G2-[d3]
Aflatoxin G2 labelled standard. Aflatoxins B1, B2, G1, G2 are secondary metabolites of fungal species such as Aspergillus flavus or Aspergillus parasiticus growing on a variety of foods (peanuts, nuts, spices, cereals). Aflatoxins are a group of very carcinogenic mycotoxins with hepatotoxic effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003232 |
| Pricing | Inquire |
| Cas | 1217758-21-8 |
| Molecular Weight | 333.31 |
| Molecular Formula | C17H11D3O7 |
| Canonical SMILES | COC1=C2C3=C(C(=O)OCC3)C(=O)OC2=C4C5CCOC5OC4=C1 |