Methyl 6-O-(N-heptylcarbamoyl)-a-D-glucopyranoside
Methyl 6-O-(N-heptylcarbamoyl)-α-D-glucopyranoside, a prevalent substance in the biomedical field, serves as a crucial research aid in deciphering intricate cell membrane signaling and molecular recognition pathways. Moreover, its versatile applicability in drug development studies catering to an array of ailments such as cancer, diabetes, and inflammation makes it a valuable tool.
| Supplier | BOC Sciences |
|---|---|
| Product # | 115457-83-5 |
| Pricing | Inquire |
| Cas | 115457-83-5 |
| Molecular Weight | 335.39 |
| Molecular Formula | C15H29NO7 |
| Canonical SMILES | CCCCCCCNC(=O)OCC1C(C(C(C(O1)OC)O)O)O |