2-Acetylthioethanesulfonic Acid-[d4] Sodium Salt
2-Acetylthioethanesulfonic Acid-[d4] Sodium Salt, is the labelled analogue of 2-Acetylthioethanesulfonic Acid Sodium Salt, which is an impurity of Mesna. Mesna is a medication used in those taking cyclophosphamide or ifosfamide to decrease the risk of bleeding from the bladder.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002005 |
| Pricing | Inquire |
| Cas | 1315627-78-1 |
| Molecular Weight | 210.24 |
| Molecular Formula | C4H3D4NaO4S2 |
| Canonical SMILES | CC(=O)SCCS(=O)(=O)[O-].[Na+] |