Akt Inhibitor IV
Akt inhibitor IV is an inhibitor of Akt activation that inhibits Akt-mediated nuclear export of Forkhead box class O transcription factor 1a (FOXO1a; IC50 = 625 nM) and reduces phosphorylation of Akt at Ser473 and Thr308 in a dose-dependent manner.
| Supplier | BOC Sciences |
|---|---|
| Product # | 681281-88-9 |
| Pricing | Inquire |
| Cas | 681281-88-9 |
| Molecular Weight | 614.6 |
| Molecular Formula | C31H27N4S·I |
| Canonical SMILES | CC[N+]1=C(N(C2=C1C=C(C=C2)C3=NC4=CC=CC=C4S3)C5=CC=CC=C5)C=CN(C)C6=CC=CC=C6.[I-] |