2-(4-Methylbenzyl)thioadenosine
2-(4-Methylbenzyl)thioadenosine, a pharmacological warrior to combat cancer and autoimmune pathologies through bolstering immunity, halting cancer progression, and reducing inflammation. Its unique mechanism of action enables it to be a trenchant tool for researchers examining the mechanisms of immunity and cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-16-4 |
| Pricing | Inquire |
| Cas | 2095417-16-4 |
| Molecular Weight | 403.46 |
| Molecular Formula | C18H21N5O4S |
| Canonical SMILES | CC1=CC=C(C=C1)CSC2=NC(=C3C(=N2)N(C=N3)C4C(C(C(O4)CO)O)O)N |