2'-Deoxy-5'-O-DMT-N4-Fmoc-5-methylcytidine
2'-Deoxy-5'-O-DMT-N4-Fmoc-5-methylcytidine, a remarkable compound hailed in biomedical research, exhibits promise in combating specific ailments. The intricate nature of its chemical composition renders it invaluable for the advancement of targeted pharmaceuticals designed to address diverse maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 176755-86-5 |
| Pricing | Inquire |
| Cas | 176755-86-5 |
| Molecular Weight | 765.85 |
| Molecular Formula | C46H43N3O8 |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C5CC(C(O5)COC(C6=CC=CC=C6)(C7=CC=C(C=C7)OC)C8=CC=C(C=C8)OC)O |