Fmoc-L-aspartic acid
N-Fmoc-L-aspartic acid is an N-Fmoc-protected form of L-Aspartic acid. L-Aspartic acid is a non-essential amino acid that is used to biosynthesize other amino acids within the human body. L-Aspartic acid also increases membrane conductance of mammalian neurons by voltage-dependent means, causing depolarization and nerve impulses that travel to key areas of the central nervous system.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003732 |
| Pricing | Inquire |
| Cas | 119062-05-4 |
| Molecular Weight | 355.35 |
| Molecular Formula | C19H17NO6 |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C(=O)O |