Diclofenac Potassium
Diclofenac potassium is a nonsteroidal anti-inflammatory drug (NSAID) taken to reduce inflammation and as an analgesic reducing pain in certain conditions. It is a competitive inhibitor of cyclooxygenase (COX) that suppresses the production of prostaglandins. Diclofenac potassium induces apoptosis of neural stem cells (NSCs) via the activation of the caspase cascade.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-059596 |
| Pricing | Inquire |
| Cas | 15307-81-0 |
| Molecular Weight | 334.24 |
| Molecular Formula | C14H10Cl2KNO2 |
| Canonical SMILES | C1=CC=C(C(=C1)CC(=O)[O-])NC2=C(C=CC=C2Cl)Cl.[K+] |