Pantoprazole EP Impurity C
An impurity of Pantoprazole which is used to treat erosive esophagitis (damage to the esophagus from stomach acid), and other conditions involving excess stomach acid such as Zollinger-Ellison syndrome.
| Supplier | BOC Sciences |
|---|---|
| Product # | 97963-62-7 |
| Pricing | Inquire |
| Cas | 97963-62-7 |
| Molecular Weight | 216.21 |
| Molecular Formula | C8H6F2N2OS |
| Canonical SMILES | C1=CC2=C(C=C1OC(F)F)NC(=S)N2 |