TC-S 7006
TC-S 7006 is a potent, selective and reversible Tpl2 (Cot; MAP3K8) inhibitor (IC50 = 50 nM) with selectivity for Tpl2 over MEK, p38, Src, MK2, PKC and EGFR. TC-S 7006 was shown to inhibit LPS-induced TNF-α secretion from primary human monocytes and attenuate acute myeloid leukemia (AML) cell proliferation in vitro. TC-S 7006 also suppresses cytolytic activity of human CD8+ cytotoxic T lymphocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 871307-18-5 |
| Pricing | Inquire |
| Cas | 871307-18-5 |
| Molecular Weight | 404.83 |
| Molecular Formula | C21H14ClFN6 |
| Canonical SMILES | C1=CC(=CN=C1)CNC2=NC=C3C(=C2)C(=C(C=N3)C#N)NC4=CC(=C(C=C4)F)Cl |