2,5-Anhydro-D-glucitol-6-phosphate
2,5-Anhydro-D-glucitol-6-phosphate is a crucial compound in the biomedical industry, known for its potential therapeutic applications in research of diabetes and related metabolic disorders. Extensive research suggests that 2,5-Anhydro-D-glucitol-6-phosphate could be a tool in the development of novel drugs for diabetes management.
| Supplier | BOC Sciences |
|---|---|
| Product # | 73548-76-2 |
| Pricing | Inquire |
| Cas | 73548-76-2 |
| Molecular Weight | 244.14 |
| Molecular Formula | C6H13O8P |
| Canonical SMILES | C(C1C(C(C(O1)COP(=O)(O)O)O)O)O |