DMT-PEG Phosphoramidite 20
DMT-PEG Phosphoramidite 20 is a phosphoramidite compound utilized in oligonucleotide synthesis. It contains a DMT (dimethoxytrityl) protective group and a polyethylene glycol (PEG) linker, allowing for the introduction of PEG moieties into oligonucleotide sequences, which can confer various properties such as enhanced solubility or altered binding affinity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00737 |
| Pricing | Inquire |
| Cas | 165682-45-1 |
| Molecular Weight | 828.98 |
| Molecular Formula | C44H65N2O11P |
| Canonical SMILES | N#CCCOP(OCCOCCOCCOCCOCCOCCOCCOC(C=1C=CC=CC1)(C2=CC=C(OC)C=C2)C3=CC=C(OC)C=C3)N(C(C)C)C(C)C |