N1-Methyl ara-uridine
N1-Methyl ara-uridine is an exceptional compound, holding applications in studying diverse diseases such as cancer. It has the remarkable capability to selectively target malignant cells. By functioning as a robust inhibitor, it obstructs the rampant growth of cancerous cells while facilitating programmed cell death.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17676-62-9 |
| Pricing | Inquire |
| Cas | 17676-62-9 |
| Molecular Weight | 258.23 |
| Molecular Formula | C10H14N2O6 |
| Canonical SMILES | CN1C(=O)C=CN(C1=O)C2C(C(C(O2)CO)O)O |