Rosuvastatin EP Impurity G calcium salt
Rosuvastatin EP Impurity G calcium salt is an impurity of Rosuvastatin, which is a statin medication used to prevent cardiovascular disease in those at high risk and treat abnormal lipids.
Supplier | BOC Sciences |
---|---|
Product # | B2694-383946 |
Pricing | Inquire |
Cas | 2414245-11-5 |
Molecular Weight | 500.57 |
Molecular Formula | C22H28FN3O6S.1/2Ca |
Canonical SMILES | CC(C)C1=NC(=NC(=C1C=CC(CC(CC(=O)[O-])O)O)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C.CC(C)C1=NC(=NC(=C1C=CC(CC(CC(=O)[O-])O)O)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C.[Ca+2] |