Omeprazole Impurity 60
Omeprazole Impurity 60 is an impurity of Omeprazole. Omeprazole is a proton pump inhibitor used in the treatment of dyspepsia. It binds to the proton pump hydrogen-potassium adenosine triphosphatase (H+/K+ ATPase) and inhibits its activity and the parietal cell secretion of H+ ions into the gastric lumen.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121459-89-0 |
| Pricing | Inquire |
| Cas | 121459-89-0 |
| Molecular Weight | 363.86 |
| Molecular Formula | C17H18ClN3O2S |
| Canonical SMILES | CC1=C[N+]2=C(CSN3C2=NC4=C3C=C(C=C4)OC)C(=C1OC)C.[Cl-] |