(D-Phe5,Cys6,11,N-Me-D-Trp8)-Somatostatin-14 (5-12) amide
(D-Phe5,Cys6,11,N-Me-D-Trp8)-Somatostatin-14 (5-12) amide, a synthetic somatostatin analogue, is selective for human somatostatin receptor subtype 5 (hsst5) and has similar binding affinity to somatostatin-28, with Kd±SEM values of 1200, 23.5±3.92, 11.05±1.03, >1000 and 0.61±0.36 nM for hsst1, hsst2, hsst3, hsst4 and hsst5, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015274 |
| Pricing | Inquire |
| Cas | 340821-13-8 |
| Molecular Weight | 1046.26 |
| Molecular Formula | C50H67N11O10S2 |
| Canonical SMILES | CC(C1C(=O)NC(CSSCC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N1)CCCCN)CC2=CNC3=CC=CC=C32)C)CC4=CC=CC=C4)NC(=O)C(CC5=CC=CC=C5)N)C(=O)NC(C(C)O)C(=O)N)O |