5-alpha-pregnan-3-alpha-ol-20-one-[17,21,21,21-d4]
An isotope labelled metabolite of Progesterone. Progesterone is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species. Progesterone is also a crucial metabolic intermediate in the production of other endogenous steroids, including the sex hormones and the corticosteroids, and plays an important role in brain function as a neurosteroid.
| Supplier | BOC Sciences |
|---|---|
| Product # | 203805-85-0 |
| Pricing | Inquire |
| Cas | 203805-85-0 |
| Molecular Weight | 322.52 |
| Molecular Formula | C21H30D4O2 |
| Canonical SMILES | CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C |