1-Cyclopentyl-1H-pyrazole-4-boronic acid pinacol ester
1-Cyclopentyl-1H-pyrazole-4-boronic acid pinacol ester is a specialized reagent in medicinal chemistry, used in Suzuki-Miyaura Cross-coupling reactions. It's particularly effective in the synthesis of bioactive molecules often involved in anticancer and antiviral treatments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1233526-60-7 |
| Pricing | Inquire |
| Cas | 1233526-60-7 |
| Molecular Weight | 262.16 |
| Molecular Formula | C14H23BN2O2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3CCCC3 |